ChemNet > CAS > 374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
| product Name |
4-Bromo-2,3-difluorobenzeneboronic acid |
| Synonyms |
4-Bromo-2,3-difluorophenylboronic acid |
| Molecular Formula |
C6H4BBrF2O2 |
| Molecular Weight |
236.8066 |
| InChI |
InChI=1/C6H4BBrF2O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| CAS Registry Number |
374790-99-5 |
| Molecular Structure |
|
| Density |
1.82g/cm3 |
| Boiling point |
312.6°C at 760 mmHg |
| Refractive index |
1.547 |
| Flash point |
142.8°C |
| Vapour Pressur |
0.000224mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
